Benzene and substituted derivatives
Filtered Search Results
4-Nitroanisole, 99+%
CAS: 100-17-4 Molecular Formula: C7H7NO3 Molecular Weight (g/mol): 153.14 MDL Number: MFCD00007327 InChI Key: BNUHAJGCKIQFGE-UHFFFAOYSA-N Synonym: 4-nitroanisole,p-nitroanisole,4-methoxynitrobenzene,p-methoxynitrobenzene,benzene, 1-methoxy-4-nitro,nitroanisole,p-nitroanisol,anisole, p-nitro,4-nitrophenyl methyl ether,unii-g989z7wolh PubChem CID: 7485 ChEBI: CHEBI:1911 IUPAC Name: 1-methoxy-4-nitrobenzene SMILES: COC1=CC=C(C=C1)[N+]([O-])=O
| PubChem CID | 7485 |
|---|---|
| CAS | 100-17-4 |
| Molecular Weight (g/mol) | 153.14 |
| ChEBI | CHEBI:1911 |
| MDL Number | MFCD00007327 |
| SMILES | COC1=CC=C(C=C1)[N+]([O-])=O |
| Synonym | 4-nitroanisole,p-nitroanisole,4-methoxynitrobenzene,p-methoxynitrobenzene,benzene, 1-methoxy-4-nitro,nitroanisole,p-nitroanisol,anisole, p-nitro,4-nitrophenyl methyl ether,unii-g989z7wolh |
| IUPAC Name | 1-methoxy-4-nitrobenzene |
| InChI Key | BNUHAJGCKIQFGE-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO3 |
2-Amino-4-(trifluoromethyl)thiophenol hydrochloride, 97%
CAS: 4274-38-8 Molecular Formula: C7H7ClF3NS Molecular Weight (g/mol): 229.65 MDL Number: MFCD00042600 InChI Key: FIAGYDIJZOWVAB-UHFFFAOYSA-N Synonym: 2-amino-4-trifluoromethyl benzenethiol hydrochloride,3-amino-4-mercaptobenzotrifluoride hydrochloride,2-amino-4-trifluoromethylthiophenol hydrochloride,2-amino-4-trifluoromethyl benzene-1-thiol hydrochloride,2-amino-4-trifluoromethyl thiophenol hydrochloride,2-amino-4-trifluoromethyl benzene-1-thiol, chloride,pubchem2827,c7h6f3ns.hcl,dsstox_cid_31681,dsstox_rid_97532 PubChem CID: 2734678 IUPAC Name: 2-amino-4-(trifluoromethyl)benzenethiol;hydrochloride SMILES: [H+].[Cl-].NC1=CC(=CC=C1S)C(F)(F)F
| PubChem CID | 2734678 |
|---|---|
| CAS | 4274-38-8 |
| Molecular Weight (g/mol) | 229.65 |
| MDL Number | MFCD00042600 |
| SMILES | [H+].[Cl-].NC1=CC(=CC=C1S)C(F)(F)F |
| Synonym | 2-amino-4-trifluoromethyl benzenethiol hydrochloride,3-amino-4-mercaptobenzotrifluoride hydrochloride,2-amino-4-trifluoromethylthiophenol hydrochloride,2-amino-4-trifluoromethyl benzene-1-thiol hydrochloride,2-amino-4-trifluoromethyl thiophenol hydrochloride,2-amino-4-trifluoromethyl benzene-1-thiol, chloride,pubchem2827,c7h6f3ns.hcl,dsstox_cid_31681,dsstox_rid_97532 |
| IUPAC Name | 2-amino-4-(trifluoromethyl)benzenethiol;hydrochloride |
| InChI Key | FIAGYDIJZOWVAB-UHFFFAOYSA-N |
| Molecular Formula | C7H7ClF3NS |
3,4-Diaminobenzoic acid, 97%
CAS: 619-05-6 Molecular Formula: C7H8N2O2 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00007726 InChI Key: HEMGYNNCNNODNX-UHFFFAOYSA-N Synonym: benzoic acid, 3,4-diamino,4-carboxyphenyldiamine,3,4-diamino benzoic acid,4-carboxy-o-phenylenediamine,3,4-diaminobenzoicacid,acmc-209mxf,3,4-diaminobenzoesaeure,3,4 diaminobenzoic acid,3,4-diaminobenzenoic acid,3,4-diamino-benzoic acid PubChem CID: 69263 IUPAC Name: 3,4-diaminobenzoic acid SMILES: C1=CC(=C(C=C1C(=O)O)N)N
| PubChem CID | 69263 |
|---|---|
| CAS | 619-05-6 |
| Molecular Weight (g/mol) | 152.15 |
| MDL Number | MFCD00007726 |
| SMILES | C1=CC(=C(C=C1C(=O)O)N)N |
| Synonym | benzoic acid, 3,4-diamino,4-carboxyphenyldiamine,3,4-diamino benzoic acid,4-carboxy-o-phenylenediamine,3,4-diaminobenzoicacid,acmc-209mxf,3,4-diaminobenzoesaeure,3,4 diaminobenzoic acid,3,4-diaminobenzenoic acid,3,4-diamino-benzoic acid |
| IUPAC Name | 3,4-diaminobenzoic acid |
| InChI Key | HEMGYNNCNNODNX-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight (g/mol) | 265.4 |
|---|---|
| Color | Colorless to Yellow |
| Physical Form | Viscous Liquid |
| UN Number | 2735 |
| Chemical Name or Material | 2,4,6-Tris(dimethylaminomethyl)phenol |
| CAS | 90-72-2 |
| Infrared Spectrum | Conforms |
| MDL Number | 00008330 |
| Packaging | Glass bottle |
| Flash Point | 149°C |
| Health Hazard 1 | Exclamation mark |
| Alpha Vector | TRISDIMETHYLAMINOMETHYLPHENOL |
| Refractive Index | 1.5150 to 1.5170 (20°C, 589 nm) |
| RTECS Number | SN3500000 |
| Recommended Storage | Normal conditions |
| Shelf Life | 5 years |
| Molecular Formula | C15 H27 N3 O |
| EINECS Number | 202-013-9 |
2,2-Diphenylethanol, 97%
CAS: 1883-32-5 Molecular Formula: C14H14O Molecular Weight (g/mol): 198.26 MDL Number: MFCD00004729 InChI Key: NYLOEXLAXYHOHH-UHFFFAOYSA-N Synonym: beta-phenylphenethyl alcohol,2,2-diphenyl ethanol,benzeneethanol, .beta.-phenyl,acmc-20aojg,2,2-diphenyl-ethanol,2,2-diphenyl-1-ethanol,2,2-diphenylethan-1-ol,benzeneethanol, b-phenyl,2,2-diphenylethanol,ksc539o6l PubChem CID: 74662 IUPAC Name: 2,2-diphenylethanol SMILES: C1=CC=C(C=C1)C(CO)C2=CC=CC=C2
| PubChem CID | 74662 |
|---|---|
| CAS | 1883-32-5 |
| Molecular Weight (g/mol) | 198.26 |
| MDL Number | MFCD00004729 |
| SMILES | C1=CC=C(C=C1)C(CO)C2=CC=CC=C2 |
| Synonym | beta-phenylphenethyl alcohol,2,2-diphenyl ethanol,benzeneethanol, .beta.-phenyl,acmc-20aojg,2,2-diphenyl-ethanol,2,2-diphenyl-1-ethanol,2,2-diphenylethan-1-ol,benzeneethanol, b-phenyl,2,2-diphenylethanol,ksc539o6l |
| IUPAC Name | 2,2-diphenylethanol |
| InChI Key | NYLOEXLAXYHOHH-UHFFFAOYSA-N |
| Molecular Formula | C14H14O |
3-Iodobenzoic acid, 98%
CAS: 618-51-9 Molecular Formula: C7H5IO2 Molecular Weight (g/mol): 248.01 MDL Number: MFCD00002496 InChI Key: KVBWBCRPWVKFQT-UHFFFAOYSA-N Synonym: m-iodobenzoic acid,benzoic acid, 3-iodo,3-iodo-benzoic acid,benzoic acid, m-iodo,3-iodobenzoicacid,3-carboxyiodobenzene,3-iodo benzoic acid,pubchem3925,acmc-209mwv,meta-carboxy iodo-benzene PubChem CID: 12060 IUPAC Name: 3-iodobenzoic acid SMILES: C1=CC(=CC(=C1)I)C(=O)O
| PubChem CID | 12060 |
|---|---|
| CAS | 618-51-9 |
| Molecular Weight (g/mol) | 248.01 |
| MDL Number | MFCD00002496 |
| SMILES | C1=CC(=CC(=C1)I)C(=O)O |
| Synonym | m-iodobenzoic acid,benzoic acid, 3-iodo,3-iodo-benzoic acid,benzoic acid, m-iodo,3-iodobenzoicacid,3-carboxyiodobenzene,3-iodo benzoic acid,pubchem3925,acmc-209mwv,meta-carboxy iodo-benzene |
| IUPAC Name | 3-iodobenzoic acid |
| InChI Key | KVBWBCRPWVKFQT-UHFFFAOYSA-N |
| Molecular Formula | C7H5IO2 |
Hexafluorobenzene, 99%
CAS: 392-56-3 Molecular Formula: C6F6 Molecular Weight (g/mol): 186.056 MDL Number: MFCD00000288 InChI Key: ZQBFAOFFOQMSGJ-UHFFFAOYSA-N Synonym: hexafluorobenzene,perfluorobenzene,benzene, hexafluoro,hexafluorbenzol,unii-cmc18t611k,benzene, 1,2,3,4,5,6-hexafluoro,hexa fluorobenzene,hexafluoro benzene,pubchem18879,acmc-1bmus PubChem CID: 9805 ChEBI: CHEBI:38589 IUPAC Name: 1,2,3,4,5,6-hexafluorobenzene SMILES: C1(=C(C(=C(C(=C1F)F)F)F)F)F
| PubChem CID | 9805 |
|---|---|
| CAS | 392-56-3 |
| Molecular Weight (g/mol) | 186.056 |
| ChEBI | CHEBI:38589 |
| MDL Number | MFCD00000288 |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)F |
| Synonym | hexafluorobenzene,perfluorobenzene,benzene, hexafluoro,hexafluorbenzol,unii-cmc18t611k,benzene, 1,2,3,4,5,6-hexafluoro,hexa fluorobenzene,hexafluoro benzene,pubchem18879,acmc-1bmus |
| IUPAC Name | 1,2,3,4,5,6-hexafluorobenzene |
| InChI Key | ZQBFAOFFOQMSGJ-UHFFFAOYSA-N |
| Molecular Formula | C6F6 |
1,3-Dioxolane, 99.8%, anhydrous, stabilized with 75 ppm BHT, AcroSeal™
CAS: 646-06-0 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 InChI Key: WNXJIVFYUVYPPR-UHFFFAOYSA-N Synonym: dioxolane,glycolformal,formal glycol,1,3-dioxolan,1,3-dioxacyclopentane,1,3-dioxalane,ethylene glycol formal,glycol methylene ether,glycol formal,dioxolan czech PubChem CID: 31404 ChEBI: CHEBI:34247 IUPAC Name: 2,6-ditert-butyl-4-methylphenol SMILES: CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C
| PubChem CID | 31404 |
|---|---|
| CAS | 646-06-0 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:34247 |
| SMILES | CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
| Synonym | dioxolane,glycolformal,formal glycol,1,3-dioxolan,1,3-dioxacyclopentane,1,3-dioxalane,ethylene glycol formal,glycol methylene ether,glycol formal,dioxolan czech |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol |
| InChI Key | WNXJIVFYUVYPPR-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
(2-Hydroxyethyl)triphenylphosphonium bromide, 98+%
CAS: 7237-34-5 Molecular Formula: C20H20BrOP Molecular Weight (g/mol): 387.26 MDL Number: MFCD00011901 InChI Key: QZJOQNHOOVSESC-UHFFFAOYSA-M Synonym: 2-hydroxyethyl triphenylphosphonium bromide,2-hydroxyethyl triphenylphosphanium bromide,acmc-20appe,2-hydroxyethyltriphenylphosphonium bromide,2-hydroxyethyl triphenyphosphonium bromide,2-hydroxyethyl triphenyl phosphanium bromide,2-hydroxy ethyl triphenylphosphonium bromide,phosphonium, 2-hydroxyethyl triphenyl-,bromide 1:1,phosphonium, 2-hydroxyethyl triphenyl-, bromide 1:1 PubChem CID: 2733550 IUPAC Name: 2-hydroxyethyl(triphenyl)phosphanium;bromide SMILES: [Br-].OCC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 2733550 |
|---|---|
| CAS | 7237-34-5 |
| Molecular Weight (g/mol) | 387.26 |
| MDL Number | MFCD00011901 |
| SMILES | [Br-].OCC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2-hydroxyethyl triphenylphosphonium bromide,2-hydroxyethyl triphenylphosphanium bromide,acmc-20appe,2-hydroxyethyltriphenylphosphonium bromide,2-hydroxyethyl triphenyphosphonium bromide,2-hydroxyethyl triphenyl phosphanium bromide,2-hydroxy ethyl triphenylphosphonium bromide,phosphonium, 2-hydroxyethyl triphenyl-,bromide 1:1,phosphonium, 2-hydroxyethyl triphenyl-, bromide 1:1 |
| IUPAC Name | 2-hydroxyethyl(triphenyl)phosphanium;bromide |
| InChI Key | QZJOQNHOOVSESC-UHFFFAOYSA-M |
| Molecular Formula | C20H20BrOP |
Methyltriphenylphosphonium chloride, 97%, Thermo Scientific Chemicals
CAS: 1031-15-8 Molecular Formula: C19H18ClP Molecular Weight (g/mol): 312.78 MDL Number: MFCD00797851 InChI Key: QRPRIOOKPZSVFN-UHFFFAOYSA-M Synonym: methyltriphenylphosphonium chloride,methyl triphenyl phosphonium chloride,phosphonium, methyltriphenyl-, chloride,methyltriphenylphosphanium chloride,methyltriphenylphosphoniumchloride,methyl triphenylphosphoniumchloride,methyl triphenylphosphonium chloride,methyl triphenyl phosphanium chloride PubChem CID: 9879809 IUPAC Name: methyl(triphenyl)phosphanium;chloride SMILES: [Cl-].C[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 9879809 |
|---|---|
| CAS | 1031-15-8 |
| Molecular Weight (g/mol) | 312.78 |
| MDL Number | MFCD00797851 |
| SMILES | [Cl-].C[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | methyltriphenylphosphonium chloride,methyl triphenyl phosphonium chloride,phosphonium, methyltriphenyl-, chloride,methyltriphenylphosphanium chloride,methyltriphenylphosphoniumchloride,methyl triphenylphosphoniumchloride,methyl triphenylphosphonium chloride,methyl triphenyl phosphanium chloride |
| IUPAC Name | methyl(triphenyl)phosphanium;chloride |
| InChI Key | QRPRIOOKPZSVFN-UHFFFAOYSA-M |
| Molecular Formula | C19H18ClP |
4-Bromobenzoyl chloride, 98+%
CAS: 586-75-4 Molecular Formula: C7H4BrClO Molecular Weight (g/mol): 219.46 MDL Number: MFCD00000683 InChI Key: DENKGPBHLYFNGK-UHFFFAOYSA-N Synonym: p-bromobenzoyl chloride,benzoyl chloride, 4-bromo,benzoyl chloride, p-bromo,4-bromobenzoylchloride,p-bromobenzoyl chloride, p-bromo,4-bromobenzoic acid chloride,p-brombenzoylchlorid,4bromobenzoyl chloride,p-brc6h4cocl,4-bromo-benzoylchloride PubChem CID: 68515 IUPAC Name: 4-bromobenzoyl chloride SMILES: ClC(=O)C1=CC=C(Br)C=C1
| PubChem CID | 68515 |
|---|---|
| CAS | 586-75-4 |
| Molecular Weight (g/mol) | 219.46 |
| MDL Number | MFCD00000683 |
| SMILES | ClC(=O)C1=CC=C(Br)C=C1 |
| Synonym | p-bromobenzoyl chloride,benzoyl chloride, 4-bromo,benzoyl chloride, p-bromo,4-bromobenzoylchloride,p-bromobenzoyl chloride, p-bromo,4-bromobenzoic acid chloride,p-brombenzoylchlorid,4bromobenzoyl chloride,p-brc6h4cocl,4-bromo-benzoylchloride |
| IUPAC Name | 4-bromobenzoyl chloride |
| InChI Key | DENKGPBHLYFNGK-UHFFFAOYSA-N |
| Molecular Formula | C7H4BrClO |
Ethyl benzoate, 99%
CAS: 93-89-0 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00009109 InChI Key: MTZQAGJQAFMTAQ-UHFFFAOYSA-N Synonym: benzoic acid, ethyl ester,benzoic ether,ethyl benzenecarboxylate,ethylbenzoate,benzoyl ethyl ether,benzoic acid ethyl ester,ethylester kyseliny benzoove,natural,unii-j115brj15h,fema no. 2422 PubChem CID: 7165 IUPAC Name: ethyl benzoate SMILES: CCOC(=O)C1=CC=CC=C1
| PubChem CID | 7165 |
|---|---|
| CAS | 93-89-0 |
| Molecular Weight (g/mol) | 150.177 |
| MDL Number | MFCD00009109 |
| SMILES | CCOC(=O)C1=CC=CC=C1 |
| Synonym | benzoic acid, ethyl ester,benzoic ether,ethyl benzenecarboxylate,ethylbenzoate,benzoyl ethyl ether,benzoic acid ethyl ester,ethylester kyseliny benzoove,natural,unii-j115brj15h,fema no. 2422 |
| IUPAC Name | ethyl benzoate |
| InChI Key | MTZQAGJQAFMTAQ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
5-Sulfosalicylic acid dihydrate, ACS reagent
CAS: 5965-83-3 Molecular Formula: C9H14O6S Molecular Weight (g/mol): 250.27 MDL Number: MFCD00007508,MFCD00149540 InChI Key: NFYHZVWMQHQKRU-UHFFFAOYSA-N Synonym: 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd PubChem CID: 2723734 IUPAC Name: 2-hydroxy-5-sulfobenzoic acid;dihydrate SMILES: C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O
| PubChem CID | 2723734 |
|---|---|
| CAS | 5965-83-3 |
| Molecular Weight (g/mol) | 250.27 |
| MDL Number | MFCD00007508,MFCD00149540 |
| SMILES | C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O |
| Synonym | 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd |
| IUPAC Name | 2-hydroxy-5-sulfobenzoic acid;dihydrate |
| InChI Key | NFYHZVWMQHQKRU-UHFFFAOYSA-N |
| Molecular Formula | C9H14O6S |
4-Nitro-2-(trifluoromethyl)aniline, 98%
CAS: 121-01-7 Molecular Formula: C7H5F3N2O2 Molecular Weight (g/mol): 206.124 MDL Number: MFCD00007365 InChI Key: HOTZLWVITTVZGY-UHFFFAOYSA-N Synonym: 2-amino-5-nitrobenzotrifluoride,4-nitro-2-trifluoromethyl aniline,2-amino-5-nitro-trifluorobenzene,4-nitro-alpha,alpha,alpha-trifluoro-o-toluidine,4-nitro-2-trifluoromethyl benzenamine,4-nitro-a,a,a-trifluoro-o-toluidine,benzenamine, 4-nitro-2-trifluoromethyl,5-nitro-2-aminobenzotrifluoride,2-trifluoromethyl-4-nitroaniline,a,a,a-trifluoro-4-nitro-o-toluidine PubChem CID: 67128 IUPAC Name: 4-nitro-2-(trifluoromethyl)aniline SMILES: C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)N
| PubChem CID | 67128 |
|---|---|
| CAS | 121-01-7 |
| Molecular Weight (g/mol) | 206.124 |
| MDL Number | MFCD00007365 |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)N |
| Synonym | 2-amino-5-nitrobenzotrifluoride,4-nitro-2-trifluoromethyl aniline,2-amino-5-nitro-trifluorobenzene,4-nitro-alpha,alpha,alpha-trifluoro-o-toluidine,4-nitro-2-trifluoromethyl benzenamine,4-nitro-a,a,a-trifluoro-o-toluidine,benzenamine, 4-nitro-2-trifluoromethyl,5-nitro-2-aminobenzotrifluoride,2-trifluoromethyl-4-nitroaniline,a,a,a-trifluoro-4-nitro-o-toluidine |
| IUPAC Name | 4-nitro-2-(trifluoromethyl)aniline |
| InChI Key | HOTZLWVITTVZGY-UHFFFAOYSA-N |
| Molecular Formula | C7H5F3N2O2 |
1,4-Diethoxybenzene, 98%
CAS: 122-95-2 Molecular Formula: C10H14O2 Molecular Weight (g/mol): 166.22 MDL Number: MFCD00015146 InChI Key: VWGNFIQXBYRDCH-UHFFFAOYSA-N Synonym: benzene, 1,4-diethoxy,p-diethoxybenzene,hydroquinone diethyl ether,benzene, p-diethoxy,diethoxybenzene,1,4-diethoxy-benzen,benzene,4-diethoxy,1,4-diethoxybenzol,hydroquinonedlethylether,acmc-209ans PubChem CID: 67150 IUPAC Name: 1,4-diethoxybenzene SMILES: CCOC1=CC=C(OCC)C=C1
| PubChem CID | 67150 |
|---|---|
| CAS | 122-95-2 |
| Molecular Weight (g/mol) | 166.22 |
| MDL Number | MFCD00015146 |
| SMILES | CCOC1=CC=C(OCC)C=C1 |
| Synonym | benzene, 1,4-diethoxy,p-diethoxybenzene,hydroquinone diethyl ether,benzene, p-diethoxy,diethoxybenzene,1,4-diethoxy-benzen,benzene,4-diethoxy,1,4-diethoxybenzol,hydroquinonedlethylether,acmc-209ans |
| IUPAC Name | 1,4-diethoxybenzene |
| InChI Key | VWGNFIQXBYRDCH-UHFFFAOYSA-N |
| Molecular Formula | C10H14O2 |